C19H19Cl2FN2O5S — CID 2465525
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 2465525) has the molecular formula C19H19Cl2FN2O5S and a molecular weight of 477.34 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2465525 |
| Molecular Formula | C19H19Cl2FN2O5S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc(Cl)cc2F)c1 |
| InChI | InChI=1S/C19H19Cl2FN2O5S/c1-3-24(4-2)30(27,28)13-6-7-15(21)14(10-13)19(26)29-11-18(25)23-17-8-5-12(20)9-16(17)22/h5-10H,3-4,11H2,1-2H3,(H,23,25) |
| InChIKey | GJZVGNYFBIZZQK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |