C16H21ClN2O7S — CID 2510081
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 2510081) has the molecular formula C16H21ClN2O7S and a molecular weight of 420.87 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2510081 |
| Molecular Formula | C16H21ClN2O7S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1Cl |
| InChI | InChI=1S/C16H21ClN2O7S/c1-4-19(5-2)27(23,24)11-7-8-13(17)12(9-11)15(21)26-10-14(20)18-16(22)25-6-3/h7-9H,4-6,10H2,1-3H3,(H,18,20,22) |
| InChIKey | AEFIENIGIYWOFV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |