C25H26N2O4S — CID 55675150
N-[2-(2-phenylethoxy)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55675150) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[2-(2-phenylethoxy)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-(2-phenylethoxy)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55675150 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[2-(2-phenylethoxy)phenyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccccc1OCCc1ccccc1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C25H26N2O4S/c28-25(21-11-8-12-22(19-21)32(29,30)27-16-6-7-17-27)26-23-13-4-5-14-24(23)31-18-15-20-9-2-1-3-10-20/h1-5,8-14,19H,6-7,15-18H2,(H,26,28) |
| InChIKey | DSZTVCFAAKPBLE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |