C18H18N2O6S — CID 30783557
(4-methoxyphenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate (PubChem CID 30783557) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is (4-methoxyphenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (4-methoxyphenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 30783557 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (4-methoxyphenyl) 3-(3-oxopiperazin-1-yl)sulfonylbenzoate |
| SMILES | COc1ccc(OC(=O)c2cccc(S(=O)(=O)N3CCNC(=O)C3)c2)cc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-25-14-5-7-15(8-6-14)26-18(22)13-3-2-4-16(11-13)27(23,24)20-10-9-19-17(21)12-20/h2-8,11H,9-10,12H2,1H3,(H,19,21) |
| InChIKey | JEZDZPUZGXIHTQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|