C17H15F2N3O4S — CID 55559568
N-(2,4-difluorophenyl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 55559568) has the molecular formula C17H15F2N3O4S and a molecular weight of 395.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(2,4-difluorophenyl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55559568 |
| Molecular Formula | C17H15F2N3O4S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)Nc3ccc(F)cc3F)c2)CCN1 |
| InChI | InChI=1S/C17H15F2N3O4S/c18-12-4-5-15(14(19)9-12)21-17(24)11-2-1-3-13(8-11)27(25,26)22-7-6-20-16(23)10-22/h1-5,8-9H,6-7,10H2,(H,20,23)(H,21,24) |
| InChIKey | YOGVGSXKTAYMNA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |