C21H27N3O6S2 — CID 55984470
3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(dimethylsulfamoyl)phenyl]benzamide (PubChem CID 55984470) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(dimethylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(dimethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55984470 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(dimethylsulfamoyl)phenyl]benzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)Nc3ccccc3S(=O)(=O)N(C)C)c2)CC(C)O1 |
| InChI | InChI=1S/C21H27N3O6S2/c1-15-13-24(14-16(2)30-15)31(26,27)18-9-7-8-17(12-18)21(25)22-19-10-5-6-11-20(19)32(28,29)23(3)4/h5-12,15-16H,13-14H2,1-4H3,(H,22,25) |
| InChIKey | SDXWUUKSGBXWKW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |