C18H24Cl2N4O3S — CID 154900458
3-piperazin-1-ylsulfonyl-N-(2-pyridin-4-ylethyl)benzamide;dihydrochloride (PubChem CID 154900458) has the molecular formula C18H24Cl2N4O3S and a molecular weight of 447.39 g/mol. Its IUPAC name is 3-piperazin-1-ylsulfonyl-N-(2-pyridin-4-ylethyl)benzamide;dihydrochloride.
| Compound Name | 3-piperazin-1-ylsulfonyl-N-(2-pyridin-4-ylethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 154900458 |
| Molecular Formula | C18H24Cl2N4O3S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 3-piperazin-1-ylsulfonyl-N-(2-pyridin-4-ylethyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCc1ccncc1)c1cccc(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H22N4O3S.2ClH/c23-18(21-9-6-15-4-7-19-8-5-15)16-2-1-3-17(14-16)26(24,25)22-12-10-20-11-13-22;;/h1-5,7-8,14,20H,6,9-13H2,(H,21,23);2*1H |
| InChIKey | LZIMWDFRPISCKP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |