C11H16N4O3S — CID 141457773
3-piperazin-1-ylsulfonylbenzohydrazide (PubChem CID 141457773) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-piperazin-1-ylsulfonylbenzohydrazide.
| Compound Name | 3-piperazin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 141457773 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-piperazin-1-ylsulfonylbenzohydrazide |
| SMILES | NNC(=O)c1cccc(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C11H16N4O3S/c12-14-11(16)9-2-1-3-10(8-9)19(17,18)15-6-4-13-5-7-15/h1-3,8,13H,4-7,12H2,(H,14,16) |
| InChIKey | HLCYIQNIFBVNTG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|