C17H24N2O5S — CID 70769591
4-(cyclopropylsulfamoyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide (PubChem CID 70769591) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 70769591 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1(CO)CCOCC1)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c20-12-17(7-9-24-10-8-17)11-18-16(21)13-1-5-15(6-2-13)25(22,23)19-14-3-4-14/h1-2,5-6,14,19-20H,3-4,7-12H2,(H,18,21) |
| InChIKey | ZULSKQJEFRCLMJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |