C25H35N3O3S — CID 4981250
2,4-ditert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol (PubChem CID 4981250) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 4981250 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 2,4-ditert-butyl-6-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]phenol |
| SMILES | CC(C)(C)c1cc(/N=N/c2ccc(S(=O)(=O)N3CCCCC3)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H35N3O3S/c1-24(2,3)18-16-21(25(4,5)6)23(29)22(17-18)27-26-19-10-12-20(13-11-19)32(30,31)28-14-8-7-9-15-28/h10-13,16-17,29H,7-9,14-15H2,1-6H3/b27-26+ |
| InChIKey | RXXQHGDOAMMMCM-CYYJNZCTSA-N |
| XLogP | 6.58 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|