C30H24N2O3S — CID 137151306
N-benzyl-N-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]benzenesulfonamide (PubChem CID 137151306) has the molecular formula C30H24N2O3S and a molecular weight of 492.60 g/mol. Its IUPAC name is N-benzyl-N-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]benzenesulfonamide.
| Compound Name | N-benzyl-N-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 137151306 |
| Molecular Formula | C30H24N2O3S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-benzyl-N-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1ccccc1)c1ccc(/N=C/c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H24N2O3S/c33-30-20-15-24-11-7-8-14-28(24)29(30)21-31-25-16-18-26(19-17-25)32(22-23-9-3-1-4-10-23)36(34,35)27-12-5-2-6-13-27/h1-21,33H,22H2/b31-21+ |
| InChIKey | XZZMQBHYQCFRQK-NJZRLIGZSA-N |
| XLogP | 6.69 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|