C15H12N6O2 — CID 136790243
2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4-phenyldiazenylphenol (PubChem CID 136790243) has the molecular formula C15H12N6O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4-phenyldiazenylphenol.
| Compound Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4-phenyldiazenylphenol |
|---|---|
| PubChem CID | 136790243 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethyl]-4-phenyldiazenylphenol |
| SMILES | Nc1nonc1/N=C/c1cc(/N=N/c2ccccc2)ccc1O |
| InChI | InChI=1S/C15H12N6O2/c16-14-15(21-23-20-14)17-9-10-8-12(6-7-13(10)22)19-18-11-4-2-1-3-5-11/h1-9,22H,(H2,16,20)/b17-9+,19-18+ |
| InChIKey | KUDUAAFMXRFREC-VBNSEIGASA-N |
| XLogP | 3.52 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|