C22H15ClN2O7 — CID 19171712
[4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 3-chlorobenzoate (PubChem CID 19171712) has the molecular formula C22H15ClN2O7 and a molecular weight of 454.82 g/mol. Its IUPAC name is [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 3-chlorobenzoate.
| Compound Name | [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 19171712 |
| Molecular Formula | C22H15ClN2O7 |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 3-chlorobenzoate |
| SMILES | COc1cc(/C=C/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClN2O7/c1-31-21-11-14(5-7-15-8-9-18(24(27)28)13-19(15)25(29)30)6-10-20(21)32-22(26)16-3-2-4-17(23)12-16/h2-13H,1H3/b7-5+ |
| InChIKey | QTYKVQQHZDQNEL-FNORWQNLSA-N |
| XLogP | 5.55 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|