C25H19BrN2O8 — CID 19166102
[4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate (PubChem CID 19166102) has the molecular formula C25H19BrN2O8 and a molecular weight of 555.34 g/mol. Its IUPAC name is [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19166102 |
| Molecular Formula | C25H19BrN2O8 |
| Molecular Weight | 555.34 g/mol |
| Exact Mass | 554.03 |
| IUPAC Name | [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(/C=C/c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2OC)cc1Br |
| InChI | InChI=1S/C25H19BrN2O8/c1-34-22-10-4-16(13-20(22)26)6-12-25(29)36-23-11-5-17(14-24(23)35-2)3-7-18-8-9-19(27(30)31)15-21(18)28(32)33/h3-15H,1-2H3/b7-3+,12-6+ |
| InChIKey | KBMPLNZKKMBSIA-MUNPBLSCSA-N |
| XLogP | 6.07 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.34 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|