About 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene
1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene (PubChem CID 22712636) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene.
Analyze 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene?
The IUPAC name of 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene (CID 22712636) is 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene.
What is the SMILES notation for 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene?
The canonical SMILES for 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene is CC(C)(C)/C=C/c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene?
The InChIKey is CHBPVVHSEGDALK-VAWYXSNFSA-N. The full InChI is InChI=1S/C16H24/c1-15(2,3)12-11-13-7-9-14(10-8-13)16(4,5)6/h7-12H,1-6H3/b12-11+.
What are the key properties of 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene?
1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene has a molecular weight of 216.37 g/mol, XLogP of 5.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[(E)-3,3-dimethylbut-1-enyl]benzene is sourced from PubChem (CID 22712636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).