C23H14F7NO3 — CID 135003848
[4-(4-methylphenyl)-3-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate (PubChem CID 135003848) has the molecular formula C23H14F7NO3 and a molecular weight of 485.36 g/mol. Its IUPAC name is [4-(4-methylphenyl)-3-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [4-(4-methylphenyl)-3-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 135003848 |
| Molecular Formula | C23H14F7NO3 |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [4-(4-methylphenyl)-3-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C)cc2)c(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1 |
| InChI | InChI=1S/C23H14F7NO3/c1-10-3-5-12(6-4-10)14-8-7-13(34-11(2)32)9-15(14)22(33)31-21-19(26)17(24)16(23(28,29)30)18(25)20(21)27/h3-9H,1-2H3,(H,31,33) |
| InChIKey | JMNKSFVHLYKCAC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|