C22H14F7NO — CID 135055453
2-methyl-6-(4-methylphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide (PubChem CID 135055453) has the molecular formula C22H14F7NO and a molecular weight of 441.35 g/mol. Its IUPAC name is 2-methyl-6-(4-methylphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-methyl-6-(4-methylphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 135055453 |
| Molecular Formula | C22H14F7NO |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-methyl-6-(4-methylphenyl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(-c2cccc(C)c2C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H14F7NO/c1-10-6-8-12(9-7-10)13-5-3-4-11(2)14(13)21(31)30-20-18(25)16(23)15(22(27,28)29)17(24)19(20)26/h3-9H,1-2H3,(H,30,31) |
| InChIKey | RPUCCJYBCQQKNW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|