C18H8F7N3O3 — CID 19513305
3-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 19513305) has the molecular formula C18H8F7N3O3 and a molecular weight of 447.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19513305 |
| Molecular Formula | C18H8F7N3O3 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1cc(-c2ccc3c(c2)OCO3)n[nH]1 |
| InChI | InChI=1S/C18H8F7N3O3/c19-12-11(18(23,24)25)13(20)15(22)16(14(12)21)26-17(29)8-4-7(27-28-8)6-1-2-9-10(3-6)31-5-30-9/h1-4H,5H2,(H,26,29)(H,27,28) |
| InChIKey | VVDKLYBZVSHPSH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|