C18H14N4O5 — CID 19513232
3-(1,3-benzodioxol-5-yl)-N-(4-methyl-2-nitrophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19513232) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(4-methyl-2-nitrophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(4-methyl-2-nitrophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19513232 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(4-methyl-2-nitrophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccc4c(c3)OCO4)n[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O5/c1-10-2-4-12(15(6-10)22(24)25)19-18(23)14-8-13(20-21-14)11-3-5-16-17(7-11)27-9-26-16/h2-8H,9H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | REFZQASTJZAJET-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|