C12H7Br3N2O — CID 114022639
3,5-dibromo-N-(6-bromo-2-pyridinyl)benzamide (PubChem CID 114022639) has the molecular formula C12H7Br3N2O and a molecular weight of 434.91 g/mol. Its IUPAC name is 3,5-dibromo-N-(6-bromo-2-pyridinyl)benzamide.
| Compound Name | 3,5-dibromo-N-(6-bromo-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 114022639 |
| Molecular Formula | C12H7Br3N2O |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 431.81 |
| IUPAC Name | 3,5-dibromo-N-(6-bromo-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1cccc(Br)n1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H7Br3N2O/c13-8-4-7(5-9(14)6-8)12(18)17-11-3-1-2-10(15)16-11/h1-6H,(H,16,17,18) |
| InChIKey | XOHKGZFRTCOAKV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|