C14H8Br2N2OS — CID 29371541
4,5-dibromo-N-isoquinolin-5-ylthiophene-2-carboxamide (PubChem CID 29371541) has the molecular formula C14H8Br2N2OS and a molecular weight of 412.11 g/mol. Its IUPAC name is 4,5-dibromo-N-isoquinolin-5-ylthiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-isoquinolin-5-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 29371541 |
| Molecular Formula | C14H8Br2N2OS |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 409.87 |
| IUPAC Name | 4,5-dibromo-N-isoquinolin-5-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2cnccc12)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H8Br2N2OS/c15-10-6-12(20-13(10)16)14(19)18-11-3-1-2-8-7-17-5-4-9(8)11/h1-7H,(H,18,19) |
| InChIKey | CSJUCENTWFNGKU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |