C9H5Br2N3OS — CID 112723253
4,5-dibromo-N,N-bis(cyanomethyl)thiophene-2-carboxamide (PubChem CID 112723253) has the molecular formula C9H5Br2N3OS and a molecular weight of 363.03 g/mol. Its IUPAC name is 4,5-dibromo-N,N-bis(cyanomethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N,N-bis(cyanomethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112723253 |
| Molecular Formula | C9H5Br2N3OS |
| Molecular Weight | 363.03 g/mol |
| Exact Mass | 360.85 |
| IUPAC Name | 4,5-dibromo-N,N-bis(cyanomethyl)thiophene-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H5Br2N3OS/c10-6-5-7(16-8(6)11)9(15)14(3-1-12)4-2-13/h5H,3-4H2 |
| InChIKey | NMUZIFBRDBQQJY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.03 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|