C12H13N3OS — CID 78805824
N,N-bis(cyanomethyl)-4-ethyl-5-methylthiophene-2-carboxamide (PubChem CID 78805824) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-4-ethyl-5-methylthiophene-2-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)-4-ethyl-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78805824 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N,N-bis(cyanomethyl)-4-ethyl-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)N(CC#N)CC#N)sc1C |
| InChI | InChI=1S/C12H13N3OS/c1-3-10-8-11(17-9(10)2)12(16)15(6-4-13)7-5-14/h8H,3,6-7H2,1-2H3 |
| InChIKey | BWOOYPMHTJHUOT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|