C17H11F3N2O2S2 — CID 123536512
N-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1-benzothiophene-2-carboxamide (PubChem CID 123536512) has the molecular formula C17H11F3N2O2S2 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 123536512 |
| Molecular Formula | C17H11F3N2O2S2 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-[(1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbutan-2-ylidene)amino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CC(=NNC(=O)c1cc2ccccc2s1)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C17H11F3N2O2S2/c18-17(19,20)15(9-11(23)13-6-3-7-25-13)21-22-16(24)14-8-10-4-1-2-5-12(10)26-14/h1-8H,9H2,(H,22,24) |
| InChIKey | BGZIENAGLKRIPV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|