C15H12ClNO2S3 — CID 126852663
5-chloro-N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 126852663) has the molecular formula C15H12ClNO2S3 and a molecular weight of 369.92 g/mol. Its IUPAC name is 5-chloro-N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126852663 |
| Molecular Formula | C15H12ClNO2S3 |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 5-chloro-N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(-c2cccs2)s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H12ClNO2S3/c16-14-6-5-13(22-14)15(19)17-8-9(18)10-3-4-12(21-10)11-2-1-7-20-11/h1-7,9,18H,8H2,(H,17,19) |
| InChIKey | NJCHCMMGWIESRX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |