C15H13NO2S3 — CID 126852656
N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide (PubChem CID 126852656) has the molecular formula C15H13NO2S3 and a molecular weight of 335.48 g/mol. Its IUPAC name is N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126852656 |
| Molecular Formula | C15H13NO2S3 |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-[2-hydroxy-2-(5-thiophen-2-ylthiophen-2-yl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(-c2cccs2)s1)c1cccs1 |
| InChI | InChI=1S/C15H13NO2S3/c17-10(9-16-15(18)14-4-2-8-20-14)11-5-6-13(21-11)12-3-1-7-19-12/h1-8,10,17H,9H2,(H,16,18) |
| InChIKey | DMNIJMPQFMPMRG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |