C13H11F2NO2S — CID 111451534
N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide (PubChem CID 111451534) has the molecular formula C13H11F2NO2S and a molecular weight of 283.30 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111451534 |
| Molecular Formula | C13H11F2NO2S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC(O)c1c(F)cccc1F)c1cccs1 |
| InChI | InChI=1S/C13H11F2NO2S/c14-8-3-1-4-9(15)12(8)10(17)7-16-13(18)11-5-2-6-19-11/h1-6,10,17H,7H2,(H,16,18) |
| InChIKey | VGSVZLFOHFSPFM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |