C16H12F2N2O2 — CID 111451257
4-cyano-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]benzamide (PubChem CID 111451257) has the molecular formula C16H12F2N2O2 and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-cyano-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]benzamide.
| Compound Name | 4-cyano-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 111451257 |
| Molecular Formula | C16H12F2N2O2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-cyano-N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCC(O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H12F2N2O2/c17-12-2-1-3-13(18)15(12)14(21)9-20-16(22)11-6-4-10(8-19)5-7-11/h1-7,14,21H,9H2,(H,20,22) |
| InChIKey | JLIFBRAJWBHEPS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |