C16H15F2NO2S — CID 111451310
N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-4-methylsulfanylbenzamide (PubChem CID 111451310) has the molecular formula C16H15F2NO2S and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-4-methylsulfanylbenzamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 111451310 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)NCC(O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H15F2NO2S/c1-22-11-7-5-10(6-8-11)16(21)19-9-14(20)15-12(17)3-2-4-13(15)18/h2-8,14,20H,9H2,1H3,(H,19,21) |
| InChIKey | VDVIOMHVWZAJKW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |