C11H14ClN3O4S — CID 61440287
2-[[2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]acetyl]amino]acetic acid (PubChem CID 61440287) has the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. Its IUPAC name is 2-[[2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 61440287 |
| Molecular Formula | C11H14ClN3O4S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[[2-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]acetyl]amino]acetic acid |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C11H14ClN3O4S/c1-15(6-7-2-3-8(12)20-7)11(19)14-4-9(16)13-5-10(17)18/h2-3H,4-6H2,1H3,(H,13,16)(H,14,19)(H,17,18) |
| InChIKey | PETLEFPBALGXHS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |