C11H13ClN2O4S — CID 61440000
4-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid (PubChem CID 61440000) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 4-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61440000 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-[[(5-chlorothiophen-2-yl)methyl-methylcarbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H13ClN2O4S/c1-14(6-7-2-3-8(12)19-7)11(18)13-9(15)4-5-10(16)17/h2-3H,4-6H2,1H3,(H,16,17)(H,13,15,18) |
| InChIKey | UJFXSQSLTHLKFS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |