C11H15ClN2S — CID 106046568
3-[2-(5-chlorothiophen-2-yl)ethylamino]pentanenitrile (PubChem CID 106046568) has the molecular formula C11H15ClN2S and a molecular weight of 242.77 g/mol. Its IUPAC name is 3-[2-(5-chlorothiophen-2-yl)ethylamino]pentanenitrile.
| Compound Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]pentanenitrile |
|---|---|
| PubChem CID | 106046568 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]pentanenitrile |
| SMILES | CCC(CC#N)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H15ClN2S/c1-2-9(5-7-13)14-8-6-10-3-4-11(12)15-10/h3-4,9,14H,2,5-6,8H2,1H3 |
| InChIKey | WXGYSRHMCPKBJG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |