C15H17Cl2NS2 — CID 66139408
1-(2-chlorophenyl)sulfanyl-3-(5-chlorothiophen-2-yl)-N-ethylpropan-2-amine (PubChem CID 66139408) has the molecular formula C15H17Cl2NS2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-3-(5-chlorothiophen-2-yl)-N-ethylpropan-2-amine.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-3-(5-chlorothiophen-2-yl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 66139408 |
| Molecular Formula | C15H17Cl2NS2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-3-(5-chlorothiophen-2-yl)-N-ethylpropan-2-amine |
| SMILES | CCNC(CSc1ccccc1Cl)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H17Cl2NS2/c1-2-18-11(9-12-7-8-15(17)20-12)10-19-14-6-4-3-5-13(14)16/h3-8,11,18H,2,9-10H2,1H3 |
| InChIKey | ZBMJOZNSJSXPPY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |