C13H18ClN5S — CID 107049697
1-(2-chlorophenyl)sulfanyl-N-ethyl-3-(2-methyltetrazol-5-yl)propan-2-amine (PubChem CID 107049697) has the molecular formula C13H18ClN5S and a molecular weight of 311.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-N-ethyl-3-(2-methyltetrazol-5-yl)propan-2-amine.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-N-ethyl-3-(2-methyltetrazol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 107049697 |
| Molecular Formula | C13H18ClN5S |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-N-ethyl-3-(2-methyltetrazol-5-yl)propan-2-amine |
| SMILES | CCNC(CSc1ccccc1Cl)Cc1nnn(C)n1 |
| InChI | InChI=1S/C13H18ClN5S/c1-3-15-10(8-13-16-18-19(2)17-13)9-20-12-7-5-4-6-11(12)14/h4-7,10,15H,3,8-9H2,1-2H3 |
| InChIKey | NVZBSEMUCGKCFY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |