C12H15ClFN5 — CID 107996069
1-(4-chloro-3-fluorophenyl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine (PubChem CID 107996069) has the molecular formula C12H15ClFN5 and a molecular weight of 283.74 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107996069 |
| Molecular Formula | C12H15ClFN5 |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N-ethyl-2-(2-methyltetrazol-5-yl)ethanamine |
| SMILES | CCNC(Cc1nnn(C)n1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H15ClFN5/c1-3-15-11(7-12-16-18-19(2)17-12)8-4-5-9(13)10(14)6-8/h4-6,11,15H,3,7H2,1-2H3 |
| InChIKey | BWFPPBRGPHLBEG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |