C13H21ClN2OS — CID 103170459
[1-(5-chlorothiophen-2-yl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine (PubChem CID 103170459) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is [1-(5-chlorothiophen-2-yl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine.
| Compound Name | [1-(5-chlorothiophen-2-yl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103170459 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [1-(5-chlorothiophen-2-yl)-3-(3-ethoxycyclobutyl)propan-2-yl]hydrazine |
| SMILES | CCOC1CC(CC(Cc2ccc(Cl)s2)NN)C1 |
| InChI | InChI=1S/C13H21ClN2OS/c1-2-17-11-6-9(7-11)5-10(16-15)8-12-3-4-13(14)18-12/h3-4,9-11,16H,2,5-8,15H2,1H3 |
| InChIKey | FONKTXWIBCCIED-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|