C14H20ClNS2 — CID 79965548
2-(2-chlorophenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine (PubChem CID 79965548) has the molecular formula C14H20ClNS2 and a molecular weight of 301.91 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine.
| Compound Name | 2-(2-chlorophenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79965548 |
| Molecular Formula | C14H20ClNS2 |
| Molecular Weight | 301.91 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccccc1Cl)C1CSCCS1 |
| InChI | InChI=1S/C14H20ClNS2/c1-2-16-13(14-10-17-7-8-18-14)9-11-5-3-4-6-12(11)15/h3-6,13-14,16H,2,7-10H2,1H3 |
| InChIKey | WOTJVIHXYFMSAM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |