C17H27NS2 — CID 116544805
N-[1,4-dithian-2-yl-[3-(2-methylpropyl)phenyl]methyl]ethanamine (PubChem CID 116544805) has the molecular formula C17H27NS2 and a molecular weight of 309.54 g/mol. Its IUPAC name is N-[1,4-dithian-2-yl-[3-(2-methylpropyl)phenyl]methyl]ethanamine.
| Compound Name | N-[1,4-dithian-2-yl-[3-(2-methylpropyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116544805 |
| Molecular Formula | C17H27NS2 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-[1,4-dithian-2-yl-[3-(2-methylpropyl)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1cccc(CC(C)C)c1)C1CSCCS1 |
| InChI | InChI=1S/C17H27NS2/c1-4-18-17(16-12-19-8-9-20-16)15-7-5-6-14(11-15)10-13(2)3/h5-7,11,13,16-18H,4,8-10,12H2,1-3H3 |
| InChIKey | WCSUBRHQBYSZFR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |