C12H25NS2 — CID 107896735
1-(1,4-dithian-2-yl)-N-ethyl-2-methylpentan-1-amine (PubChem CID 107896735) has the molecular formula C12H25NS2 and a molecular weight of 247.47 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-ethyl-2-methylpentan-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-ethyl-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 107896735 |
| Molecular Formula | C12H25NS2 |
| Molecular Weight | 247.47 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-ethyl-2-methylpentan-1-amine |
| SMILES | CCCC(C)C(NCC)C1CSCCS1 |
| InChI | InChI=1S/C12H25NS2/c1-4-6-10(3)12(13-5-2)11-9-14-7-8-15-11/h10-13H,4-9H2,1-3H3 |
| InChIKey | NRUNVFZDTQDBJW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |