C12H16ClFN2O2 — CID 102868515
[2-(3-chloro-2-fluorophenyl)-1-(1,4-dioxan-2-yl)ethyl]hydrazine (PubChem CID 102868515) has the molecular formula C12H16ClFN2O2 and a molecular weight of 274.72 g/mol. Its IUPAC name is [2-(3-chloro-2-fluorophenyl)-1-(1,4-dioxan-2-yl)ethyl]hydrazine.
| Compound Name | [2-(3-chloro-2-fluorophenyl)-1-(1,4-dioxan-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102868515 |
| Molecular Formula | C12H16ClFN2O2 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [2-(3-chloro-2-fluorophenyl)-1-(1,4-dioxan-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Cl)c1F)C1COCCO1 |
| InChI | InChI=1S/C12H16ClFN2O2/c13-9-3-1-2-8(12(9)14)6-10(16-15)11-7-17-4-5-18-11/h1-3,10-11,16H,4-7,15H2 |
| InChIKey | UXKYWJAOEMBWNG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|