C14H19BrFNO2 — CID 114287335
2-(2-bromo-3-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine (PubChem CID 114287335) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-(2-bromo-3-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine.
| Compound Name | 2-(2-bromo-3-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 114287335 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(2-bromo-3-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cccc(F)c1Br)C1COCCO1 |
| InChI | InChI=1S/C14H19BrFNO2/c1-2-17-12(13-9-18-6-7-19-13)8-10-4-3-5-11(16)14(10)15/h3-5,12-13,17H,2,6-9H2,1H3 |
| InChIKey | YTIKGPQITVSADF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |