C14H19BrFNO2 — CID 65352587
2-(3-bromo-4-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine (PubChem CID 65352587) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 65352587 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1-(1,4-dioxan-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(F)c(Br)c1)C1COCCO1 |
| InChI | InChI=1S/C14H19BrFNO2/c1-2-17-13(14-9-18-5-6-19-14)8-10-3-4-12(16)11(15)7-10/h3-4,7,13-14,17H,2,5-6,8-9H2,1H3 |
| InChIKey | AEHBDANLYPKQKV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |