C15H18F2O — CID 116660061
1-(cyclohexen-1-yl)-3-(2,5-difluorophenyl)propan-2-ol (PubChem CID 116660061) has the molecular formula C15H18F2O and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(2,5-difluorophenyl)propan-2-ol.
| Compound Name | 1-(cyclohexen-1-yl)-3-(2,5-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 116660061 |
| Molecular Formula | C15H18F2O |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(2,5-difluorophenyl)propan-2-ol |
| SMILES | OC(CC1=CCCCC1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H18F2O/c16-13-6-7-15(17)12(9-13)10-14(18)8-11-4-2-1-3-5-11/h4,6-7,9,14,18H,1-3,5,8,10H2 |
| InChIKey | SYDXZUVKQXAYLM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|