C15H18BrClO — CID 116660281
1-(4-bromo-2-chlorophenyl)-3-(cyclohexen-1-yl)propan-2-ol (PubChem CID 116660281) has the molecular formula C15H18BrClO and a molecular weight of 329.67 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-(cyclohexen-1-yl)propan-2-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-(cyclohexen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 116660281 |
| Molecular Formula | C15H18BrClO |
| Molecular Weight | 329.67 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-(cyclohexen-1-yl)propan-2-ol |
| SMILES | OC(CC1=CCCCC1)Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H18BrClO/c16-13-7-6-12(15(17)10-13)9-14(18)8-11-4-2-1-3-5-11/h4,6-7,10,14,18H,1-3,5,8-9H2 |
| InChIKey | DTYFHYLECWCWQI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|