C16H21ClFN — CID 103049107
1-(5-chloro-2-fluorophenyl)-3-(cyclohexen-1-yl)-N-methylpropan-2-amine (PubChem CID 103049107) has the molecular formula C16H21ClFN and a molecular weight of 281.80 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-3-(cyclohexen-1-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-3-(cyclohexen-1-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 103049107 |
| Molecular Formula | C16H21ClFN |
| Molecular Weight | 281.80 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-3-(cyclohexen-1-yl)-N-methylpropan-2-amine |
| SMILES | CNC(CC1=CCCCC1)Cc1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H21ClFN/c1-19-15(9-12-5-3-2-4-6-12)11-13-10-14(17)7-8-16(13)18/h5,7-8,10,15,19H,2-4,6,9,11H2,1H3 |
| InChIKey | JKLSVZSSLIYALP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|