C15H17FO2 — CID 102380825
(2S)-3-(cyclohexen-1-yl)-1-(4-fluorophenyl)-2-hydroxypropan-1-one (PubChem CID 102380825) has the molecular formula C15H17FO2 and a molecular weight of 248.30 g/mol. Its IUPAC name is (2S)-3-(cyclohexen-1-yl)-1-(4-fluorophenyl)-2-hydroxypropan-1-one.
| Compound Name | (2S)-3-(cyclohexen-1-yl)-1-(4-fluorophenyl)-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 102380825 |
| Molecular Formula | C15H17FO2 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S)-3-(cyclohexen-1-yl)-1-(4-fluorophenyl)-2-hydroxypropan-1-one |
| SMILES | O=C(c1ccc(F)cc1)[C@@H](O)CC1=CCCCC1 |
| InChI | InChI=1S/C15H17FO2/c16-13-8-6-12(7-9-13)15(18)14(17)10-11-4-2-1-3-5-11/h4,6-9,14,17H,1-3,5,10H2/t14-/m0/s1 |
| InChIKey | OWHPKUAMUUUCJS-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|