C9H13Cl3O — CID 13238455
(2R)-1,1,1-trichloro-3-(cyclohexen-1-yl)propan-2-ol (PubChem CID 13238455) has the molecular formula C9H13Cl3O and a molecular weight of 243.56 g/mol. Its IUPAC name is (2R)-1,1,1-trichloro-3-(cyclohexen-1-yl)propan-2-ol.
| Compound Name | (2R)-1,1,1-trichloro-3-(cyclohexen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 13238455 |
| Molecular Formula | C9H13Cl3O |
| Molecular Weight | 243.56 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (2R)-1,1,1-trichloro-3-(cyclohexen-1-yl)propan-2-ol |
| SMILES | O[C@H](CC1=CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H13Cl3O/c10-9(11,12)8(13)6-7-4-2-1-3-5-7/h4,8,13H,1-3,5-6H2/t8-/m1/s1 |
| InChIKey | KUSFVRMWFWPWNV-MRVPVSSYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|