C18H26O — CID 116660093
1-(4-tert-butylphenyl)-2-(cyclohexen-1-yl)ethanol (PubChem CID 116660093) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(cyclohexen-1-yl)ethanol.
| Compound Name | 1-(4-tert-butylphenyl)-2-(cyclohexen-1-yl)ethanol |
|---|---|
| PubChem CID | 116660093 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(cyclohexen-1-yl)ethanol |
| SMILES | CC(C)(C)c1ccc(C(O)CC2=CCCCC2)cc1 |
| InChI | InChI=1S/C18H26O/c1-18(2,3)16-11-9-15(10-12-16)17(19)13-14-7-5-4-6-8-14/h7,9-12,17,19H,4-6,8,13H2,1-3H3 |
| InChIKey | BHPQHHZFKSUXNW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|