C18H27F2N — CID 107012123
1-(3,4-difluorophenyl)-N-propylnon-8-en-2-amine (PubChem CID 107012123) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-propylnon-8-en-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-N-propylnon-8-en-2-amine |
|---|---|
| PubChem CID | 107012123 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-propylnon-8-en-2-amine |
| SMILES | C=CCCCCCC(Cc1ccc(F)c(F)c1)NCCC |
| InChI | InChI=1S/C18H27F2N/c1-3-5-6-7-8-9-16(21-12-4-2)13-15-10-11-17(19)18(20)14-15/h3,10-11,14,16,21H,1,4-9,12-13H2,2H3 |
| InChIKey | MUPIWYYLNCPBQX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|