C17H25Cl2N — CID 107008986
1-(3,4-dichlorophenyl)-N-ethylnon-8-en-2-amine (PubChem CID 107008986) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-ethylnon-8-en-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-ethylnon-8-en-2-amine |
|---|---|
| PubChem CID | 107008986 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-ethylnon-8-en-2-amine |
| SMILES | C=CCCCCCC(Cc1ccc(Cl)c(Cl)c1)NCC |
| InChI | InChI=1S/C17H25Cl2N/c1-3-5-6-7-8-9-15(20-4-2)12-14-10-11-16(18)17(19)13-14/h3,10-11,13,15,20H,1,4-9,12H2,2H3 |
| InChIKey | UTIMQUIXKZMNIA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|